Split 75 75 into two angles where the values of the six trigonometric functions are known. sin(30+45) sin (30 + 45) Apply the sum of angles identity. sin(30)cos(45)+cos(30)sin(45) sin (30) cos (45) + cos (30) sin (45) The exact value of sin(30) sin (30) is 1 2 1 2. 1 2cos(45)+cos(30)sin(45) 1 2 cos (45) + cos (30) sin (45)

Sin 75 degrees is the value of sine trigonometric function for an angle equal to 75 degrees. The value of sin 75° is (√6 + √2)/4 or 0.9659 (approx). How to Find the Value of Sin 75 Degrees?

Dec 13, 2024 · Ex 3.3, 5 Find the value of: sin 75° sin 75° = sin (45° + 30°) = sin 45° cos 30° + cos 45° sin 30° = 𝟏/√𝟐 × √𝟑/𝟐 + 𝟏/√𝟐 × 𝟏/𝟐 = 1/√2 (√3/2 " + " 1/2) = (√𝟑 + 𝟏)/(𝟐√𝟐) Show More

Use our sin(x) calculator to find the exact value of sine of 75 degrees - sin(75 °) - or the sine of any angle in degrees and in radians.

Nov 2, 2022 · Answer: The value of sin 75 is (√3+1)/2√2. Let us find the value of sin 75 using the formula of the compound angles of sine functions. The following formula is the key to find sin 75 degree: sin (A+B) = sin A cos B + cos A sin B. Note that we can write sin 75 as follows: sin 75 = sin (45 + 30) = sin 45 ⋅ cos 30 + cos 45 ⋅ sin 30.

Answer: The value of sin75° is (√3 + 1)/ (2√2). Let's look into the steps to find the value of sin 75°. We can write sin 75° as, sin 75° = sin (45° +30° ) We know that, sin (A + B) = sin A. cos B + cos A. sin B. Thus, sin (45° + 30° ) = sin 45° . cos 30° + cos 45° . sin 30° ------------ (1) From trigonometric table, we have the following values,

Compute answers using Wolfram's breakthrough technology & knowledgebase, relied on by millions of students & professionals. For math, science, nutrition, history, geography, engineering, mathematics, linguistics, sports, finance, music…

What is the exact value of sin(75∘)? The exact value of sin (75°) is found using the sum of angles formula for sine, resulting in (sqrt (6) + sqrt (2))/4. To find the exact value of sin (75°), we can use the sum of angles formula for sine, which states that sin (A + B) = sin (A)cos (B) + cos (A)sin (B).

Dec 7, 2020 · This video works to determine the exact value for the sine of 75 degrees in two different ways: using the sum formula for sine and using the half-angle ident...

Compute answers using Wolfram's breakthrough technology & knowledgebase, relied on by millions of students & professionals. For math, science, nutrition, history, geography, engineering, mathematics, linguistics, sports, finance, music…