2019年1月21日 · I don't understand why CH3CH2C(CH3)2CH(CH2CH3)CH3 is 2 ethyl-3,3 dimethyl - pentane and not 3-methyl-4,4-dimethylhexane. When I expand the condensed formula above and count the longest carbon chain, it seem it is a hexane rather than pentane. Can someone please clarify? Homework Statement Write the IUPAC name for CH3CH2C(CH3)2CH(CH2CH3)CH3.

A. -CH2CH3 B. CH2CH3 C. -CH₃ D. -CH2CH3 What is the correct name for the following compound? CH3 CH2CH3 Chy-CH-CH2CH-CHI O A. 2,4-dimethylhexane OB. 2-ethyl-4-methylhexane OC. 3,5-dimethylheptane OD. 4-ethyl-2-methylhexane Reset Selection Which of the following pairs of molecules are structural isomers of each other? A.

CH3CH2CH(CH3)CH(CH3)CH2CH3. Name the Alkane and express the answer in IUPAC name. Its not Octane. Nevermind its 3,4-dimethylhexane.

The longest carbon chain contains 5 carbon atoms. Also, there is a methyl group at carbon-3. Thus IUPAC name is: 3-methylpentane.

Question: Draw the complete structural formula for CH3CH(CH3)CH2CH3. Draw 4 positional isomers for this molecule resulting from substitution of one chlorine atom for a hydrogen atom. Label each carbon attached to the chlorine as 1°, 2°, or 3°.

IUPAC name for the compound.CH3CH2CH2C(CH2CH3)3 Your solution’s ready to go! Our expert help has broken down your problem into an easy-to-learn solution you can count on.

Organic Chemistry Naming Alkyl GroupsWhat is the name for the alkyl group: -C(CH2CH3)3?Is this group primary, secondary, or tertiary? I know that CH2CH3 is an ethyl group, and three of these would most likely be triethyl. But don't know what …

Question: Provide the IUPAC name for the following compound: CH3CH2CH(CH2CH3)CH2CH2CH2CH(CH3)2Write the IUPAC name for the molecule shown in the Newman projection. Note for advanced students: ignore any stereochemistry when writing the IUPAC name.Give the IUPAC name for the following compound:

Identify the given organic compound, CH3CH(OH)CH2CH3, as an alcohol and note that the chain contains four carbon atoms which will help to determine the prefix for the IUPAC name. Step 1 The given organic compound is as follows:

Question: IUPAC Naming Instructions: Provide proper IUPAC names. 1. Name: (CH3)2CHCH2CH2CH(CH2CH3)CH2C(CH3)3 ANSWER: 2. Name: T Br CH2 HỊCCHCHCCHACHCH CH CH3 C(CH3 ANSWER: W 3. Name: CH2CH2CH3 CH2CHCH2CHCHCH: CH2 CH3 CH3 ANSWER: